C31H47FN4O4Si — CID 156779199
tert-butyl N-[(2S)-1,1-dicyclopropyl-3-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate (PubChem CID 156779199) has the molecular formula C31H47FN4O4Si and a molecular weight of 586.83 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1,1-dicyclopropyl-3-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1,1-dicyclopropyl-3-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 156779199 |
| Molecular Formula | C31H47FN4O4Si |
| Molecular Weight | 586.83 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | tert-butyl N-[(2S)-1,1-dicyclopropyl-3-[4-[3,5-dimethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-3-fluoroanilino]-3-oxopropan-2-yl]carbamate |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C2CC2)C2CC2)cc1F |
| InChI | InChI=1S/C31H47FN4O4Si/c1-19-26(20(2)36(35-19)18-39-15-16-41(6,7)8)24-14-13-23(17-25(24)32)33-29(37)28(34-30(38)40-31(3,4)5)27(21-9-10-21)22-11-12-22/h13-14,17,21-22,27-28H,9-12,15-16,18H2,1-8H3,(H,33,37)(H,34,38)/t28-/m0/s1 |
| InChIKey | VXGXZGNNOWCXHF-NDEPHWFRSA-N |
| XLogP | 6.89 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.83 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|