C37H52N6O3Si — CID 156779449
N-[1,1-dicyclopropyl-3-[4-[3,5-dicyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 156779449) has the molecular formula C37H52N6O3Si and a molecular weight of 656.95 g/mol. Its IUPAC name is N-[1,1-dicyclopropyl-3-[4-[3,5-dicyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[1,1-dicyclopropyl-3-[4-[3,5-dicyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 156779449 |
| Molecular Formula | C37H52N6O3Si |
| Molecular Weight | 656.95 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | N-[1,1-dicyclopropyl-3-[4-[3,5-dicyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)n1nccc1C(=O)NC(C(=O)Nc1ccc(-c2c(C3CC3)nn(COCC[Si](C)(C)C)c2C2CC2)cc1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C37H52N6O3Si/c1-23(2)43-30(18-19-38-43)36(44)40-34(31(24-6-7-24)25-8-9-25)37(45)39-29-16-14-26(15-17-29)32-33(27-10-11-27)41-42(35(32)28-12-13-28)22-46-20-21-47(3,4)5/h14-19,23-25,27-28,31,34H,6-13,20-22H2,1-5H3,(H,39,45)(H,40,44) |
| InChIKey | PKRDZOPJJYOBSE-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.95 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|