About 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine
4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine (PubChem CID 156779616) has the molecular formula C20H18FN7S
and a molecular weight of 407.48 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine |
| PubChem CID | 156779616 |
| Molecular Formula | C20H18FN7S |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(Nc2ccc(N3CCNCC3)cn2)nc1-c1ccc2ncsc2c1 |
| InChI | InChI=1S/C20H18FN7S/c21-15-11-24-20(27-19(15)13-1-3-16-17(9-13)29-12-25-16)26-18-4-2-14(10-23-18)28-7-5-22-6-8-28/h1-4,9-12,22H,5-8H2,(H,23,24,26,27) |
| InChIKey | RRJNXBNVQSVJBA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine?
The IUPAC name of 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine (CID 156779616) is 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine.
What is the SMILES notation for 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine?
The canonical SMILES for 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine is Fc1cnc(Nc2ccc(N3CCNCC3)cn2)nc1-c1ccc2ncsc2c1.
What is the InChIKey of 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine?
The InChIKey is RRJNXBNVQSVJBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN7S/c21-15-11-24-20(27-19(15)13-1-3-16-17(9-13)29-12-25-16)26-18-4-2-14(10-23-18)28-7-5-22-6-8-28/h1-4,9-12,22H,5-8H2,(H,23,24,26,27).
What are the key properties of 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine?
4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine has a molecular weight of 407.48 g/mol, XLogP of 3.44, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-6-yl)-5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine is sourced from PubChem (CID 156779616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).