C10H12O6 — CID 156779687
propyl 3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate (PubChem CID 156779687) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is propyl 3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate.
| Compound Name | propyl 3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 156779687 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | propyl 3,4,5-trihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
| SMILES | CCCOC(=O)C12C=C(O)C(O)=C(O)C1O2 |
| InChI | InChI=1S/C10H12O6/c1-2-3-15-9(14)10-4-5(11)6(12)7(13)8(10)16-10/h4,8,11-13H,2-3H2,1H3 |
| InChIKey | ASUJOXQDPUROLL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|