C15H24FNO — CID 156780048
3-fluoro-2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one (PubChem CID 156780048) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is 3-fluoro-2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one.
| Compound Name | 3-fluoro-2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one |
|---|---|
| PubChem CID | 156780048 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-fluoro-2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one |
| SMILES | C=CCN1C(C)(C)CC(=O)C(F)(CC=C)C1(C)C |
| InChI | InChI=1S/C15H24FNO/c1-7-9-15(16)12(18)11-13(3,4)17(10-8-2)14(15,5)6/h7-8H,1-2,9-11H2,3-6H3 |
| InChIKey | TVFQIGLRISXCLU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|