C12H20O3 — CID 156780168
3,3-bis(prop-2-enyl)hex-5-ene-1,1,1-triol (PubChem CID 156780168) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3,3-bis(prop-2-enyl)hex-5-ene-1,1,1-triol.
| Compound Name | 3,3-bis(prop-2-enyl)hex-5-ene-1,1,1-triol |
|---|---|
| PubChem CID | 156780168 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3,3-bis(prop-2-enyl)hex-5-ene-1,1,1-triol |
| SMILES | C=CCC(CC=C)(CC=C)CC(O)(O)O |
| InChI | InChI=1S/C12H20O3/c1-4-7-11(8-5-2,9-6-3)10-12(13,14)15/h4-6,13-15H,1-3,7-10H2 |
| InChIKey | UDXYSRDGQGEGHD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|