C8H12O3 — CID 156780470
2-methyl-2-[2-(oxiran-2-yl)ethyl]-1,3-dioxole (PubChem CID 156780470) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methyl-2-[2-(oxiran-2-yl)ethyl]-1,3-dioxole.
| Compound Name | 2-methyl-2-[2-(oxiran-2-yl)ethyl]-1,3-dioxole |
|---|---|
| PubChem CID | 156780470 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-methyl-2-[2-(oxiran-2-yl)ethyl]-1,3-dioxole |
| SMILES | CC1(CCC2CO2)OC=CO1 |
| InChI | InChI=1S/C8H12O3/c1-8(10-4-5-11-8)3-2-7-6-9-7/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | JSRUFTGZUBKSRC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|