About pyrazol-1-ylcarbamic acid;hydrochloride
pyrazol-1-ylcarbamic acid;hydrochloride (PubChem CID 156780950) has the molecular formula C4H6ClN3O2
and a molecular weight of 163.56 g/mol. Its IUPAC name is pyrazol-1-ylcarbamic acid;hydrochloride.
Molecular Properties
| Compound Name | pyrazol-1-ylcarbamic acid;hydrochloride |
| PubChem CID | 156780950 |
| Molecular Formula | C4H6ClN3O2 |
| Molecular Weight | 163.56 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | pyrazol-1-ylcarbamic acid;hydrochloride |
| SMILES | Cl.O=C(O)Nn1cccn1 |
| InChI | InChI=1S/C4H5N3O2.ClH/c8-4(9)6-7-3-1-2-5-7;/h1-3,6H,(H,8,9);1H |
| InChIKey | BIWLHHYCWHZQHK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.56 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazol-1-ylcarbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazol-1-ylcarbamic acid;hydrochloride?
The IUPAC name of pyrazol-1-ylcarbamic acid;hydrochloride (CID 156780950) is pyrazol-1-ylcarbamic acid;hydrochloride.
What is the SMILES notation for pyrazol-1-ylcarbamic acid;hydrochloride?
The canonical SMILES for pyrazol-1-ylcarbamic acid;hydrochloride is Cl.O=C(O)Nn1cccn1.
What is the InChIKey of pyrazol-1-ylcarbamic acid;hydrochloride?
The InChIKey is BIWLHHYCWHZQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2.ClH/c8-4(9)6-7-3-1-2-5-7;/h1-3,6H,(H,8,9);1H.
What are the key properties of pyrazol-1-ylcarbamic acid;hydrochloride?
pyrazol-1-ylcarbamic acid;hydrochloride has a molecular weight of 163.56 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazol-1-ylcarbamic acid;hydrochloride is sourced from PubChem (CID 156780950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).