About pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate
pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate (PubChem CID 156781189) has the molecular formula C27H31N5O3
and a molecular weight of 473.58 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate |
| PubChem CID | 156781189 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate |
| SMILES | CCN1CCN(c2ccccc2C(=O)Nc2ccc(CNC(=O)OCc3cccnc3)cc2)CC1 |
| InChI | InChI=1S/C27H31N5O3/c1-2-31-14-16-32(17-15-31)25-8-4-3-7-24(25)26(33)30-23-11-9-21(10-12-23)19-29-27(34)35-20-22-6-5-13-28-18-22/h3-13,18H,2,14-17,19-20H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | GTYQBMHURMYYGD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate?
The IUPAC name of pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate (CID 156781189) is pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate.
What is the SMILES notation for pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate?
The canonical SMILES for pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate is CCN1CCN(c2ccccc2C(=O)Nc2ccc(CNC(=O)OCc3cccnc3)cc2)CC1.
What is the InChIKey of pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate?
The InChIKey is GTYQBMHURMYYGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N5O3/c1-2-31-14-16-32(17-15-31)25-8-4-3-7-24(25)26(33)30-23-11-9-21(10-12-23)19-29-27(34)35-20-22-6-5-13-28-18-22/h3-13,18H,2,14-17,19-20H2,1H3,(H,29,34)(H,30,33).
What are the key properties of pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate?
pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate has a molecular weight of 473.58 g/mol, XLogP of 3.90, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl N-[[4-[[2-(4-ethylpiperazin-1-yl)benzoyl]amino]phenyl]methyl]carbamate is sourced from PubChem (CID 156781189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).