About 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene
5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene (PubChem CID 156781397) has the molecular formula C23H24OSe
and a molecular weight of 395.40 g/mol. Its IUPAC name is 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene.
Molecular Properties
| Compound Name | 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene |
| PubChem CID | 156781397 |
| Molecular Formula | C23H24OSe |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene |
| SMILES | COc1cc(C)c(C(C[Se]c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H24OSe/c1-17-14-20(24-3)15-18(2)23(17)22(19-10-6-4-7-11-19)16-25-21-12-8-5-9-13-21/h4-15,22H,16H2,1-3H3 |
| InChIKey | TYVFMSJQVOBUHY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene?
The IUPAC name of 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene (CID 156781397) is 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene.
What is the SMILES notation for 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene?
The canonical SMILES for 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene is COc1cc(C)c(C(C[Se]c2ccccc2)c2ccccc2)c(C)c1.
What is the InChIKey of 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene?
The InChIKey is TYVFMSJQVOBUHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24OSe/c1-17-14-20(24-3)15-18(2)23(17)22(19-10-6-4-7-11-19)16-25-21-12-8-5-9-13-21/h4-15,22H,16H2,1-3H3.
What are the key properties of 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene?
5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene has a molecular weight of 395.40 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene is sourced from PubChem (CID 156781397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).