C23H24OSe — CID 156781397
5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene (PubChem CID 156781397) has the molecular formula C23H24OSe and a molecular weight of 395.40 g/mol. Its IUPAC name is 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene.
| Compound Name | 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene |
|---|---|
| PubChem CID | 156781397 |
| Molecular Formula | C23H24OSe |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 5-methoxy-1,3-dimethyl-2-(1-phenyl-2-phenylselanylethyl)benzene |
| SMILES | COc1cc(C)c(C(C[Se]c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H24OSe/c1-17-14-20(24-3)15-18(2)23(17)22(19-10-6-4-7-11-19)16-25-21-12-8-5-9-13-21/h4-15,22H,16H2,1-3H3 |
| InChIKey | TYVFMSJQVOBUHY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|