C20H21FN2O4S — CID 156781889
N-[(6-fluoro-2-pyridinyl)sulfonyl]-1-[5-methyl-2-(1-methylcyclopropyl)phenoxy]cyclopropane-1-carboxamide (PubChem CID 156781889) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is N-[(6-fluoro-2-pyridinyl)sulfonyl]-1-[5-methyl-2-(1-methylcyclopropyl)phenoxy]cyclopropane-1-carboxamide.
| Compound Name | N-[(6-fluoro-2-pyridinyl)sulfonyl]-1-[5-methyl-2-(1-methylcyclopropyl)phenoxy]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 156781889 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[(6-fluoro-2-pyridinyl)sulfonyl]-1-[5-methyl-2-(1-methylcyclopropyl)phenoxy]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(C2(C)CC2)c(OC2(C(=O)NS(=O)(=O)c3cccc(F)n3)CC2)c1 |
| InChI | InChI=1S/C20H21FN2O4S/c1-13-6-7-14(19(2)8-9-19)15(12-13)27-20(10-11-20)18(24)23-28(25,26)17-5-3-4-16(21)22-17/h3-7,12H,8-11H2,1-2H3,(H,23,24) |
| InChIKey | IEDGOHUDHYEIEZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|