C31H31F2N7O3 — CID 156782118
[(1R,2S,5S)-3-azabicyclo[3.1.0]hexan-2-yl]-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]piperazin-1-yl]methanone (PubChem CID 156782118) has the molecular formula C31H31F2N7O3 and a molecular weight of 587.63 g/mol. Its IUPAC name is [(1R,2S,5S)-3-azabicyclo[3.1.0]hexan-2-yl]-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]piperazin-1-yl]methanone.
| Compound Name | [(1R,2S,5S)-3-azabicyclo[3.1.0]hexan-2-yl]-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 156782118 |
| Molecular Formula | C31H31F2N7O3 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | [(1R,2S,5S)-3-azabicyclo[3.1.0]hexan-2-yl]-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cnc3c(Nc4ccc(C(=O)N5CCN(C(=O)[C@H]6NC[C@H]7C[C@H]76)CC5)c(C)c4)nccn23)c(F)c1F |
| InChI | InChI=1S/C31H31F2N7O3/c1-17-13-19(3-4-20(17)30(41)38-9-11-39(12-10-38)31(42)27-22-14-18(22)15-35-27)37-28-29-36-16-23(40(29)8-7-34-28)21-5-6-24(43-2)26(33)25(21)32/h3-8,13,16,18,22,27,35H,9-12,14-15H2,1-2H3,(H,34,37)/t18-,22-,27+/m1/s1 |
| InChIKey | YVLFISKLFHDWSL-RKQHAZBESA-N |
| XLogP | 3.63 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |