About 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one
6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one (PubChem CID 156782213) has the molecular formula C12H10BrF2NO2
and a molecular weight of 318.12 g/mol. Its IUPAC name is 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one.
Molecular Properties
| Compound Name | 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one |
| PubChem CID | 156782213 |
| Molecular Formula | C12H10BrF2NO2 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one |
| SMILES | O=C1CC(N2C(=O)C(F)(F)C3CC=C(Br)C=C32)C1 |
| InChI | InChI=1S/C12H10BrF2NO2/c13-6-1-2-9-10(3-6)16(7-4-8(17)5-7)11(18)12(9,14)15/h1,3,7,9H,2,4-5H2 |
| InChIKey | NSGXSJBDESTGIE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one?
The IUPAC name of 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one (CID 156782213) is 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one.
What is the SMILES notation for 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one?
The canonical SMILES for 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one is O=C1CC(N2C(=O)C(F)(F)C3CC=C(Br)C=C32)C1.
What is the InChIKey of 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one?
The InChIKey is NSGXSJBDESTGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrF2NO2/c13-6-1-2-9-10(3-6)16(7-4-8(17)5-7)11(18)12(9,14)15/h1,3,7,9H,2,4-5H2.
What are the key properties of 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one?
6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one has a molecular weight of 318.12 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,3-difluoro-1-(3-oxocyclobutyl)-3a,4-dihydroindol-2-one is sourced from PubChem (CID 156782213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).