About 2-amino-N-(1,2,4-triazin-3-yl)acetamide
2-amino-N-(1,2,4-triazin-3-yl)acetamide (PubChem CID 15678296) has the molecular formula C5H7N5O
and a molecular weight of 153.15 g/mol. Its IUPAC name is 2-amino-N-(1,2,4-triazin-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-amino-N-(1,2,4-triazin-3-yl)acetamide |
| PubChem CID | 15678296 |
| Molecular Formula | C5H7N5O |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 2-amino-N-(1,2,4-triazin-3-yl)acetamide |
| SMILES | NCC(=O)Nc1nccnn1 |
| InChI | InChI=1S/C5H7N5O/c6-3-4(11)9-5-7-1-2-8-10-5/h1-2H,3,6H2,(H,7,9,10,11) |
| InChIKey | KCEZWZVNHYRSIP-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-(1,2,4-triazin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(1,2,4-triazin-3-yl)acetamide?
The IUPAC name of 2-amino-N-(1,2,4-triazin-3-yl)acetamide (CID 15678296) is 2-amino-N-(1,2,4-triazin-3-yl)acetamide.
What is the SMILES notation for 2-amino-N-(1,2,4-triazin-3-yl)acetamide?
The canonical SMILES for 2-amino-N-(1,2,4-triazin-3-yl)acetamide is NCC(=O)Nc1nccnn1.
What is the InChIKey of 2-amino-N-(1,2,4-triazin-3-yl)acetamide?
The InChIKey is KCEZWZVNHYRSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5O/c6-3-4(11)9-5-7-1-2-8-10-5/h1-2H,3,6H2,(H,7,9,10,11).
What are the key properties of 2-amino-N-(1,2,4-triazin-3-yl)acetamide?
2-amino-N-(1,2,4-triazin-3-yl)acetamide has a molecular weight of 153.15 g/mol, XLogP of -1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(1,2,4-triazin-3-yl)acetamide is sourced from PubChem (CID 15678296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).