About 6-iodo-[1,2]thiazolo[5,4-b]quinoline
6-iodo-[1,2]thiazolo[5,4-b]quinoline (PubChem CID 156783020) has the molecular formula C10H5IN2S
and a molecular weight of 312.14 g/mol. Its IUPAC name is 6-iodo-[1,2]thiazolo[5,4-b]quinoline.
Molecular Properties
| Compound Name | 6-iodo-[1,2]thiazolo[5,4-b]quinoline |
| PubChem CID | 156783020 |
| Molecular Formula | C10H5IN2S |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.92 |
| IUPAC Name | 6-iodo-[1,2]thiazolo[5,4-b]quinoline |
| SMILES | Ic1ccc2nc3sncc3cc2c1 |
| InChI | InChI=1S/C10H5IN2S/c11-8-1-2-9-6(4-8)3-7-5-12-14-10(7)13-9/h1-5H |
| InChIKey | BAVWXXLUZRDUTN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-[1,2]thiazolo[5,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-[1,2]thiazolo[5,4-b]quinoline?
The IUPAC name of 6-iodo-[1,2]thiazolo[5,4-b]quinoline (CID 156783020) is 6-iodo-[1,2]thiazolo[5,4-b]quinoline.
What is the SMILES notation for 6-iodo-[1,2]thiazolo[5,4-b]quinoline?
The canonical SMILES for 6-iodo-[1,2]thiazolo[5,4-b]quinoline is Ic1ccc2nc3sncc3cc2c1.
What is the InChIKey of 6-iodo-[1,2]thiazolo[5,4-b]quinoline?
The InChIKey is BAVWXXLUZRDUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5IN2S/c11-8-1-2-9-6(4-8)3-7-5-12-14-10(7)13-9/h1-5H.
What are the key properties of 6-iodo-[1,2]thiazolo[5,4-b]quinoline?
6-iodo-[1,2]thiazolo[5,4-b]quinoline has a molecular weight of 312.14 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-[1,2]thiazolo[5,4-b]quinoline is sourced from PubChem (CID 156783020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).