C16H24ClNO — CID 156783329
4a-(2,6-dimethylphenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride (PubChem CID 156783329) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 4a-(2,6-dimethylphenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride.
| Compound Name | 4a-(2,6-dimethylphenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 156783329 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 4a-(2,6-dimethylphenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;hydrochloride |
| SMILES | Cc1cccc(C)c1C12CCCCC1OCCN2.Cl |
| InChI | InChI=1S/C16H23NO.ClH/c1-12-6-5-7-13(2)15(12)16-9-4-3-8-14(16)18-11-10-17-16;/h5-7,14,17H,3-4,8-11H2,1-2H3;1H |
| InChIKey | GYBQYMVGVJFTMA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |