C26H18N2Na2O6S2 — CID 15678335
disodium;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate (PubChem CID 15678335) has the molecular formula C26H18N2Na2O6S2 and a molecular weight of 564.55 g/mol. Its IUPAC name is disodium;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate.
| Compound Name | disodium;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
|---|---|
| PubChem CID | 15678335 |
| Molecular Formula | C26H18N2Na2O6S2 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | disodium;2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline-3,8-disulfonate |
| SMILES | Cc1nc2c(ccc3c(-c4ccccc4)c(S(=O)(=O)[O-])c(C)nc32)c(-c2ccccc2)c1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C26H20N2O6S2.2Na/c1-15-25(35(29,30)31)21(17-9-5-3-6-10-17)19-13-14-20-22(18-11-7-4-8-12-18)26(36(32,33)34)16(2)28-24(20)23(19)27-15;;/h3-14H,1-2H3,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2 |
| InChIKey | RNGKZLRAVYPLJC-UHFFFAOYSA-L |
| XLogP | -1.45 |
| TPSA | 140.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|