C15H21NO — CID 156783370
7-methyl-4a-phenyl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 156783370) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 7-methyl-4a-phenyl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | 7-methyl-4a-phenyl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 156783370 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 7-methyl-4a-phenyl-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | CC1CCC2(c3ccccc3)NCCOC2C1 |
| InChI | InChI=1S/C15H21NO/c1-12-7-8-15(13-5-3-2-4-6-13)14(11-12)17-10-9-16-15/h2-6,12,14,16H,7-11H2,1H3 |
| InChIKey | OAWFPWGQGQOYTC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |