C17H23NO2 — CID 156783380
3,3-dimethyl-5a-phenyl-5,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]oxazepin-4-one (PubChem CID 156783380) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3,3-dimethyl-5a-phenyl-5,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]oxazepin-4-one.
| Compound Name | 3,3-dimethyl-5a-phenyl-5,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 156783380 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3,3-dimethyl-5a-phenyl-5,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]oxazepin-4-one |
| SMILES | CC1(C)COC2CCCCC2(c2ccccc2)NC1=O |
| InChI | InChI=1S/C17H23NO2/c1-16(2)12-20-14-10-6-7-11-17(14,18-15(16)19)13-8-4-3-5-9-13/h3-5,8-9,14H,6-7,10-12H2,1-2H3,(H,18,19) |
| InChIKey | TXGZSMYPUMRGJK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |