C21H19Cl2NO4S — CID 156783559
dimethyl 2-[2-(3,4-dichlorophenyl)-2-(1H-indol-2-ylsulfanyl)ethyl]propanedioate (PubChem CID 156783559) has the molecular formula C21H19Cl2NO4S and a molecular weight of 452.36 g/mol. Its IUPAC name is dimethyl 2-[2-(3,4-dichlorophenyl)-2-(1H-indol-2-ylsulfanyl)ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-(3,4-dichlorophenyl)-2-(1H-indol-2-ylsulfanyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 156783559 |
| Molecular Formula | C21H19Cl2NO4S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | dimethyl 2-[2-(3,4-dichlorophenyl)-2-(1H-indol-2-ylsulfanyl)ethyl]propanedioate |
| SMILES | COC(=O)C(CC(Sc1cc2ccccc2[nH]1)c1ccc(Cl)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C21H19Cl2NO4S/c1-27-20(25)14(21(26)28-2)11-18(13-7-8-15(22)16(23)9-13)29-19-10-12-5-3-4-6-17(12)24-19/h3-10,14,18,24H,11H2,1-2H3 |
| InChIKey | VSGOTZQXZNMMLR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|