About methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate
methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate (PubChem CID 156783770) has the molecular formula C18H17F2N5O2
and a molecular weight of 373.36 g/mol. Its IUPAC name is methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate |
| PubChem CID | 156783770 |
| Molecular Formula | C18H17F2N5O2 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate |
| SMILES | COC(=O)NCc1cc(-c2cn(-c3c(F)cc(N)cc3F)nn2)ccc1C |
| InChI | InChI=1S/C18H17F2N5O2/c1-10-3-4-11(5-12(10)8-22-18(26)27-2)16-9-25(24-23-16)17-14(19)6-13(21)7-15(17)20/h3-7,9H,8,21H2,1-2H3,(H,22,26) |
| InChIKey | VNLVTKDLFNVZKK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate?
The IUPAC name of methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate (CID 156783770) is methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate.
What is the SMILES notation for methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate?
The canonical SMILES for methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate is COC(=O)NCc1cc(-c2cn(-c3c(F)cc(N)cc3F)nn2)ccc1C.
What is the InChIKey of methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate?
The InChIKey is VNLVTKDLFNVZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2N5O2/c1-10-3-4-11(5-12(10)8-22-18(26)27-2)16-9-25(24-23-16)17-14(19)6-13(21)7-15(17)20/h3-7,9H,8,21H2,1-2H3,(H,22,26).
What are the key properties of methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate?
methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate has a molecular weight of 373.36 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[[5-[1-(4-amino-2,6-difluorophenyl)triazol-4-yl]-2-methylphenyl]methyl]carbamate is sourced from PubChem (CID 156783770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).