C11H14F3NO2S — CID 156784546
3,3,3-trifluoro-N-hydroxy-2,2-dimethyl-N-[(3-methylthiophen-2-yl)methyl]propanamide (PubChem CID 156784546) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-hydroxy-2,2-dimethyl-N-[(3-methylthiophen-2-yl)methyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-hydroxy-2,2-dimethyl-N-[(3-methylthiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 156784546 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3,3,3-trifluoro-N-hydroxy-2,2-dimethyl-N-[(3-methylthiophen-2-yl)methyl]propanamide |
| SMILES | Cc1ccsc1CN(O)C(=O)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2S/c1-7-4-5-18-8(7)6-15(17)9(16)10(2,3)11(12,13)14/h4-5,17H,6H2,1-3H3 |
| InChIKey | VUISRMVMNTXGDL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|