C24H22O3 — CID 156784919
(2S,3S)-2-benzoyl-3-cyclohexylspiro[cyclopropane-1,2'-indene]-1',3'-dione (PubChem CID 156784919) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2S,3S)-2-benzoyl-3-cyclohexylspiro[cyclopropane-1,2'-indene]-1',3'-dione.
| Compound Name | (2S,3S)-2-benzoyl-3-cyclohexylspiro[cyclopropane-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 156784919 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (2S,3S)-2-benzoyl-3-cyclohexylspiro[cyclopropane-1,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccccc1)[C@H]1[C@H](C2CCCCC2)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H22O3/c25-21(16-11-5-2-6-12-16)20-19(15-9-3-1-4-10-15)24(20)22(26)17-13-7-8-14-18(17)23(24)27/h2,5-8,11-15,19-20H,1,3-4,9-10H2/t19-,20+/m0/s1 |
| InChIKey | QKPMAVJPMSANBV-VQTJNVASSA-N |
| XLogP | 4.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|