C32H30Cl3FN8O2 — CID 156785261
7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile (PubChem CID 156785261) has the molecular formula C32H30Cl3FN8O2 and a molecular weight of 684.00 g/mol. Its IUPAC name is 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile.
| Compound Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 156785261 |
| Molecular Formula | C32H30Cl3FN8O2 |
| Molecular Weight | 684.00 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile |
| SMILES | C=CC(=O)N1CCN(c2c(C#N)c(=O)n(-c3c(C(C)C)ncnc3C(C)C)c3nc(-c4c(N)c(Cl)cc(Cl)c4F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C32H30Cl3FN8O2/c1-6-22(45)42-7-9-43(10-8-42)29-17-11-21(35)28(23-24(36)19(33)12-20(34)25(23)38)41-31(17)44(32(46)18(29)13-37)30-26(15(2)3)39-14-40-27(30)16(4)5/h6,11-12,14-16H,1,7-10,38H2,2-5H3 |
| InChIKey | PXVMFIYXYKYNCY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.00 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|