C28H35N3O2 — CID 156785352
N-[4-[2-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]ethyl]cyclohexyl]-1H-indole-2-carboxamide (PubChem CID 156785352) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-[4-[2-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]ethyl]cyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | N-[4-[2-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]ethyl]cyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 156785352 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | N-[4-[2-[[(1R,2R)-2-(2-methoxyphenyl)cyclopropyl]methylamino]ethyl]cyclohexyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccccc1[C@@H]1C[C@H]1CNCCC1CCC(NC(=O)c2cc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C28H35N3O2/c1-33-27-9-5-3-7-23(27)24-16-21(24)18-29-15-14-19-10-12-22(13-11-19)30-28(32)26-17-20-6-2-4-8-25(20)31-26/h2-9,17,19,21-22,24,29,31H,10-16,18H2,1H3,(H,30,32)/t19?,21-,22?,24+/m0/s1 |
| InChIKey | FCKYULPWLRPEBQ-GIFYUCOESA-N |
| XLogP | 5.25 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|