C32H12F6O6 — CID 156785375
8-[4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,5-bis(trifluoromethyl)phenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 156785375) has the molecular formula C32H12F6O6 and a molecular weight of 606.43 g/mol. Its IUPAC name is 8-[4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,5-bis(trifluoromethyl)phenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-[4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,5-bis(trifluoromethyl)phenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 156785375 |
| Molecular Formula | C32H12F6O6 |
| Molecular Weight | 606.43 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | 8-[4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,5-bis(trifluoromethyl)phenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2ccc(-c3cc(C(F)(F)F)c(-c4ccc5c6c(cccc46)C(=O)OC5=O)cc3C(F)(F)F)c3cccc1c23 |
| InChI | InChI=1S/C32H12F6O6/c33-31(34,35)23-12-22(14-8-10-20-26-16(14)4-2-6-18(26)28(40)44-30(20)42)24(32(36,37)38)11-21(23)13-7-9-19-25-15(13)3-1-5-17(25)27(39)43-29(19)41/h1-12H |
| InChIKey | CHNRIKOMIXORJY-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.43 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|