C15H17F2N3O4S — CID 156785824
[(3R)-1-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]pyrrolidin-3-yl] methanesulfonate (PubChem CID 156785824) has the molecular formula C15H17F2N3O4S and a molecular weight of 373.38 g/mol. Its IUPAC name is [(3R)-1-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]pyrrolidin-3-yl] methanesulfonate.
| Compound Name | [(3R)-1-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]pyrrolidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 156785824 |
| Molecular Formula | C15H17F2N3O4S |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [(3R)-1-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]pyrrolidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1CCN(C(=O)N2N=CC[C@H]2c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C15H17F2N3O4S/c1-25(22,23)24-13-3-5-19(9-13)15(21)20-14(2-4-18-20)10-6-11(16)8-12(17)7-10/h4,6-8,13-14H,2-3,5,9H2,1H3/t13-,14+/m1/s1 |
| InChIKey | XAAVETSZOSVOSN-KGLIPLIRSA-N |
| XLogP | 1.87 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|