About ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate
ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate (PubChem CID 15678617) has the molecular formula C24H22F2N4O4
and a molecular weight of 468.46 g/mol. Its IUPAC name is ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate.
Molecular Properties
| Compound Name | ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate |
| PubChem CID | 15678617 |
| Molecular Formula | C24H22F2N4O4 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate |
| SMILES | CCOC(=O)CC(=O)CC(O)/C=C/C(=C(c1ccc(F)cc1)c1ccc(F)cc1)n1cnnn1 |
| InChI | InChI=1S/C24H22F2N4O4/c1-2-34-23(33)14-21(32)13-20(31)11-12-22(30-15-27-28-29-30)24(16-3-7-18(25)8-4-16)17-5-9-19(26)10-6-17/h3-12,15,20,31H,2,13-14H2,1H3/b12-11+ |
| InChIKey | QZVYQAJDHISQFY-VAWYXSNFSA-N |
| XLogP | 3.20 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate?
The IUPAC name of ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate (CID 15678617) is ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate.
What is the SMILES notation for ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate?
The canonical SMILES for ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate is CCOC(=O)CC(=O)CC(O)/C=C/C(=C(c1ccc(F)cc1)c1ccc(F)cc1)n1cnnn1.
What is the InChIKey of ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate?
The InChIKey is QZVYQAJDHISQFY-VAWYXSNFSA-N. The full InChI is InChI=1S/C24H22F2N4O4/c1-2-34-23(33)14-21(32)13-20(31)11-12-22(30-15-27-28-29-30)24(16-3-7-18(25)8-4-16)17-5-9-19(26)10-6-17/h3-12,15,20,31H,2,13-14H2,1H3/b12-11+.
What are the key properties of ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate?
ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate has a molecular weight of 468.46 g/mol, XLogP of 3.20, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (6E)-9,9-bis(4-fluorophenyl)-5-hydroxy-3-oxo-8-(tetrazol-1-yl)nona-6,8-dienoate is sourced from PubChem (CID 15678617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).