About 5-azaspiro[2.4]heptane;hydrobromide
5-azaspiro[2.4]heptane;hydrobromide (PubChem CID 156786428) has the molecular formula C6H12BrN
and a molecular weight of 178.07 g/mol. Its IUPAC name is 5-azaspiro[2.4]heptane;hydrobromide.
Molecular Properties
| Compound Name | 5-azaspiro[2.4]heptane;hydrobromide |
| PubChem CID | 156786428 |
| Molecular Formula | C6H12BrN |
| Molecular Weight | 178.07 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 5-azaspiro[2.4]heptane;hydrobromide |
| SMILES | Br.C1CC2(CC2)CN1 |
| InChI | InChI=1S/C6H11N.BrH/c1-2-6(1)3-4-7-5-6;/h7H,1-5H2;1H |
| InChIKey | YULPGWZVJZRHND-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.07 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-azaspiro[2.4]heptane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azaspiro[2.4]heptane;hydrobromide?
The IUPAC name of 5-azaspiro[2.4]heptane;hydrobromide (CID 156786428) is 5-azaspiro[2.4]heptane;hydrobromide.
What is the SMILES notation for 5-azaspiro[2.4]heptane;hydrobromide?
The canonical SMILES for 5-azaspiro[2.4]heptane;hydrobromide is Br.C1CC2(CC2)CN1.
What is the InChIKey of 5-azaspiro[2.4]heptane;hydrobromide?
The InChIKey is YULPGWZVJZRHND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.BrH/c1-2-6(1)3-4-7-5-6;/h7H,1-5H2;1H.
What are the key properties of 5-azaspiro[2.4]heptane;hydrobromide?
5-azaspiro[2.4]heptane;hydrobromide has a molecular weight of 178.07 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azaspiro[2.4]heptane;hydrobromide is sourced from PubChem (CID 156786428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).