C23H22ClN3 — CID 156786739
2-(2-chlorophenyl)-5-(11-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 156786739) has the molecular formula C23H22ClN3 and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-(11-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chlorophenyl)-5-(11-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786739 |
| Molecular Formula | C23H22ClN3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(2-chlorophenyl)-5-(11-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Clc1ccccc1-c1nc2c([nH]1)CN(C1C3CCC1c1ccccc13)CC2 |
| InChI | InChI=1S/C23H22ClN3/c24-19-8-4-3-7-18(19)23-25-20-11-12-27(13-21(20)26-23)22-16-9-10-17(22)15-6-2-1-5-14(15)16/h1-8,16-17,22H,9-13H2,(H,25,26) |
| InChIKey | HJUSUSCPVQSWND-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |