C22H21ClFN3 — CID 156786781
5-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-(2-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 156786781) has the molecular formula C22H21ClFN3 and a molecular weight of 381.88 g/mol. Its IUPAC name is 5-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-(2-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 5-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-(2-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786781 |
| Molecular Formula | C22H21ClFN3 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 5-(6-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-(2-fluorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Fc1ccccc1-c1nc2c([nH]1)CN(C1CCc3cc(Cl)ccc3C1)CC2 |
| InChI | InChI=1S/C22H21ClFN3/c23-16-7-5-15-12-17(8-6-14(15)11-16)27-10-9-20-21(13-27)26-22(25-20)18-3-1-2-4-19(18)24/h1-5,7,11,17H,6,8-10,12-13H2,(H,25,26) |
| InChIKey | STQKAJISBGCPGB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |