C27H25Cl2N3 — CID 156786815
2-[2-chloro-4-(2-cyclopropylethynyl)phenyl]-5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 156786815) has the molecular formula C27H25Cl2N3 and a molecular weight of 462.42 g/mol. Its IUPAC name is 2-[2-chloro-4-(2-cyclopropylethynyl)phenyl]-5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-[2-chloro-4-(2-cyclopropylethynyl)phenyl]-5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786815 |
| Molecular Formula | C27H25Cl2N3 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-[2-chloro-4-(2-cyclopropylethynyl)phenyl]-5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Clc1ccc2c(c1)CC(N1CCc3nc(-c4ccc(C#CC5CC5)cc4Cl)[nH]c3C1)CC2 |
| InChI | InChI=1S/C27H25Cl2N3/c28-21-8-6-19-7-9-22(15-20(19)14-21)32-12-11-25-26(16-32)31-27(30-25)23-10-5-18(13-24(23)29)4-3-17-1-2-17/h5-6,8,10,13-14,17,22H,1-2,7,9,11-12,15-16H2,(H,30,31) |
| InChIKey | YJZAETHPCJJXMW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|