C23H24ClN3O2S — CID 156786833
2-(2-chlorophenyl)-5-(7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 156786833) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-(7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chlorophenyl)-5-(7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786833 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-(2-chlorophenyl)-5-(7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CC(N1CCc3nc(-c4ccccc4Cl)[nH]c3C1)CC2 |
| InChI | InChI=1S/C23H24ClN3O2S/c1-30(28,29)18-9-7-15-6-8-17(12-16(15)13-18)27-11-10-21-22(14-27)26-23(25-21)19-4-2-3-5-20(19)24/h2-5,7,9,13,17H,6,8,10-12,14H2,1H3,(H,25,26) |
| InChIKey | ARAJTVLKAZHVPV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |