C25H24Cl2N6 — CID 156786859
5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-[2-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine (PubChem CID 156786859) has the molecular formula C25H24Cl2N6 and a molecular weight of 479.42 g/mol. Its IUPAC name is 5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-[2-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine.
| Compound Name | 5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-[2-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786859 |
| Molecular Formula | C25H24Cl2N6 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 5-(7-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)-2-[2-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
| SMILES | Cn1c(-c2ccc(-n3cncn3)cc2Cl)nc2c1CN(C1CCc3ccc(Cl)cc3C1)CC2 |
| InChI | InChI=1S/C25H24Cl2N6/c1-31-24-13-32(19-5-3-16-2-4-18(26)10-17(16)11-19)9-8-23(24)30-25(31)21-7-6-20(12-22(21)27)33-15-28-14-29-33/h2,4,6-7,10,12,14-15,19H,3,5,8-9,11,13H2,1H3 |
| InChIKey | RLDZJBMTPWFMQQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |