C30H32ClN5O — CID 156786867
5-[(2S)-7-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-chlorophenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine (PubChem CID 156786867) has the molecular formula C30H32ClN5O and a molecular weight of 514.07 g/mol. Its IUPAC name is 5-[(2S)-7-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-chlorophenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine.
| Compound Name | 5-[(2S)-7-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-chlorophenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 156786867 |
| Molecular Formula | C30H32ClN5O |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 5-[(2S)-7-[2-(3-but-3-ynyldiazirin-3-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-2-(2-chlorophenyl)-3-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
| SMILES | C#CCCC1(CCOc2ccc3c(c2)C[C@@H](N2CCc4nc(-c5ccccc5Cl)n(C)c4C2)CC3)N=N1 |
| InChI | InChI=1S/C30H32ClN5O/c1-3-4-14-30(33-34-30)15-17-37-24-12-10-21-9-11-23(18-22(21)19-24)36-16-13-27-28(20-36)35(2)29(32-27)25-7-5-6-8-26(25)31/h1,5-8,10,12,19,23H,4,9,11,13-18,20H2,2H3/t23-/m0/s1 |
| InChIKey | KBCJCFGPQSVZSG-QHCPKHFHSA-N |
| XLogP | 6.00 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|