C15H10O6Pb — CID 156787133
2,4,12,14-tetraoxa-13λ2-plumbatricyclo[14.4.0.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,15-dione (PubChem CID 156787133) has the molecular formula C15H10O6Pb and a molecular weight of 493.44 g/mol. Its IUPAC name is 2,4,12,14-tetraoxa-13λ2-plumbatricyclo[14.4.0.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,15-dione.
| Compound Name | 2,4,12,14-tetraoxa-13λ2-plumbatricyclo[14.4.0.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,15-dione |
|---|---|
| PubChem CID | 156787133 |
| Molecular Formula | C15H10O6Pb |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | 2,4,12,14-tetraoxa-13λ2-plumbatricyclo[14.4.0.05,10]icosa-1(20),5,7,9,16,18-hexaene-11,15-dione |
| SMILES | O=C1O[Pb]OC(=O)c2ccccc2OCOc2ccccc21 |
| InChI | InChI=1S/C15H12O6.Pb/c16-14(17)10-5-1-3-7-12(10)20-9-21-13-8-4-2-6-11(13)15(18)19;/h1-8H,9H2,(H,16,17)(H,18,19);/q;+2/p-2 |
| InChIKey | AEWBWIDOBZBGLO-UHFFFAOYSA-L |
| XLogP | 1.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |