C11H14N2O — CID 156787158
2,4,4a,5,6,10b-hexahydro-1H-pyrano[3,4-c][1,8]naphthyridine (PubChem CID 156787158) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2,4,4a,5,6,10b-hexahydro-1H-pyrano[3,4-c][1,8]naphthyridine.
| Compound Name | 2,4,4a,5,6,10b-hexahydro-1H-pyrano[3,4-c][1,8]naphthyridine |
|---|---|
| PubChem CID | 156787158 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2,4,4a,5,6,10b-hexahydro-1H-pyrano[3,4-c][1,8]naphthyridine |
| SMILES | c1cnc2c(c1)C1CCOCC1CN2 |
| InChI | InChI=1S/C11H14N2O/c1-2-10-9-3-5-14-7-8(9)6-13-11(10)12-4-1/h1-2,4,8-9H,3,5-7H2,(H,12,13) |
| InChIKey | KTPMPXQYZOJAHT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |