C25H27N3O4 — CID 156787551
3-[3-[[4-[(6-ethyl-2,5-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]phenyl]-2-(oxiran-2-yl)propanoic acid (PubChem CID 156787551) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-[3-[[4-[(6-ethyl-2,5-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]phenyl]-2-(oxiran-2-yl)propanoic acid.
| Compound Name | 3-[3-[[4-[(6-ethyl-2,5-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]phenyl]-2-(oxiran-2-yl)propanoic acid |
|---|---|
| PubChem CID | 156787551 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 3-[3-[[4-[(6-ethyl-2,5-dimethyl-3-pyridinyl)oxy]-2-pyridinyl]amino]phenyl]-2-(oxiran-2-yl)propanoic acid |
| SMILES | CCc1nc(C)c(Oc2ccnc(Nc3cccc(CC(C(=O)O)C4CO4)c3)c2)cc1C |
| InChI | InChI=1S/C25H27N3O4/c1-4-21-15(2)10-22(16(3)27-21)32-19-8-9-26-24(13-19)28-18-7-5-6-17(11-18)12-20(25(29)30)23-14-31-23/h5-11,13,20,23H,4,12,14H2,1-3H3,(H,26,28)(H,29,30) |
| InChIKey | CPFSUGKTZUDESB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|