C10H13ClN2O2 — CID 156789139
(1R,2R)-1,2-bis(furan-2-yl)ethane-1,2-diamine;hydrochloride (PubChem CID 156789139) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is (1R,2R)-1,2-bis(furan-2-yl)ethane-1,2-diamine;hydrochloride.
| Compound Name | (1R,2R)-1,2-bis(furan-2-yl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 156789139 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (1R,2R)-1,2-bis(furan-2-yl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccco1)[C@@H](N)c1ccco1 |
| InChI | InChI=1S/C10H12N2O2.ClH/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8;/h1-6,9-10H,11-12H2;1H/t9-,10-;/m0./s1 |
| InChIKey | NRJKVGDIUZELAH-IYPAPVHQSA-N |
| XLogP | 1.99 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |