C12H16BrNO2 — CID 156789625
4-bromo-1,3,3-trimethyl-3a,4-dihydro-2H-indole-6-carboxylic acid (PubChem CID 156789625) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 4-bromo-1,3,3-trimethyl-3a,4-dihydro-2H-indole-6-carboxylic acid.
| Compound Name | 4-bromo-1,3,3-trimethyl-3a,4-dihydro-2H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 156789625 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-bromo-1,3,3-trimethyl-3a,4-dihydro-2H-indole-6-carboxylic acid |
| SMILES | CN1CC(C)(C)C2C1=CC(C(=O)O)=CC2Br |
| InChI | InChI=1S/C12H16BrNO2/c1-12(2)6-14(3)9-5-7(11(15)16)4-8(13)10(9)12/h4-5,8,10H,6H2,1-3H3,(H,15,16) |
| InChIKey | OCCFYCHRROBMSR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|