C23H22N6O4 — CID 156789758
4-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-(5-methylfuran-2-yl)pyrimidin-4-yl]amino]-2-oxoethyl]-N-hydroxybenzamide (PubChem CID 156789758) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is 4-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-(5-methylfuran-2-yl)pyrimidin-4-yl]amino]-2-oxoethyl]-N-hydroxybenzamide.
| Compound Name | 4-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-(5-methylfuran-2-yl)pyrimidin-4-yl]amino]-2-oxoethyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 156789758 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-(5-methylfuran-2-yl)pyrimidin-4-yl]amino]-2-oxoethyl]-N-hydroxybenzamide |
| SMILES | Cc1cc(C)n(-c2cc(NC(=O)Cc3ccc(C(=O)NO)cc3)nc(-c3ccc(C)o3)n2)n1 |
| InChI | InChI=1S/C23H22N6O4/c1-13-10-14(2)29(27-13)20-12-19(25-22(26-20)18-9-4-15(3)33-18)24-21(30)11-16-5-7-17(8-6-16)23(31)28-32/h4-10,12,32H,11H2,1-3H3,(H,28,31)(H,24,25,26,30) |
| InChIKey | NQTKADXASPFQAS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|