C20H21ClO4 — CID 156789863
1-(4-butoxyphenyl)-3-(4-chloro-3-methoxyphenyl)propane-1,3-dione (PubChem CID 156789863) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-(4-chloro-3-methoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(4-butoxyphenyl)-3-(4-chloro-3-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 156789863 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-(4-chloro-3-methoxyphenyl)propane-1,3-dione |
| SMILES | CCCCOc1ccc(C(=O)CC(=O)c2ccc(Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H21ClO4/c1-3-4-11-25-16-8-5-14(6-9-16)18(22)13-19(23)15-7-10-17(21)20(12-15)24-2/h5-10,12H,3-4,11,13H2,1-2H3 |
| InChIKey | MRAZLMFPLCMULD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|