C20H16F2N2O — CID 156790234
4-[1-[(3,5-difluorophenyl)methyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 156790234) has the molecular formula C20H16F2N2O and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-[1-[(3,5-difluorophenyl)methyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1-[(3,5-difluorophenyl)methyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 156790234 |
| Molecular Formula | C20H16F2N2O |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[1-[(3,5-difluorophenyl)methyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccc2ccn(Cc3cc(F)cc(F)c3)c2c1 |
| InChI | InChI=1S/C20H16F2N2O/c1-12-20(13(2)25-23-12)16-4-3-15-5-6-24(19(15)9-16)11-14-7-17(21)10-18(22)8-14/h3-10H,11H2,1-2H3 |
| InChIKey | YQKKHBURSHFINJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|