C15H25O4P — CID 156790288
(2,4-ditert-butyl-6-methylidenecyclohexa-2,4-dien-1-yl) dihydrogen phosphate (PubChem CID 156790288) has the molecular formula C15H25O4P and a molecular weight of 300.34 g/mol. Its IUPAC name is (2,4-ditert-butyl-6-methylidenecyclohexa-2,4-dien-1-yl) dihydrogen phosphate.
| Compound Name | (2,4-ditert-butyl-6-methylidenecyclohexa-2,4-dien-1-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 156790288 |
| Molecular Formula | C15H25O4P |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2,4-ditert-butyl-6-methylidenecyclohexa-2,4-dien-1-yl) dihydrogen phosphate |
| SMILES | C=C1C=C(C(C)(C)C)C=C(C(C)(C)C)C1OP(=O)(O)O |
| InChI | InChI=1S/C15H25O4P/c1-10-8-11(14(2,3)4)9-12(15(5,6)7)13(10)19-20(16,17)18/h8-9,13H,1H2,2-7H3,(H2,16,17,18) |
| InChIKey | TYQHJXSZVRDKAE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|