C12H19FN2 — CID 156792123
1-[(1Z,3Z)-4-ethyl-1-fluorohexa-1,3,5-trienyl]piperazine (PubChem CID 156792123) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-[(1Z,3Z)-4-ethyl-1-fluorohexa-1,3,5-trienyl]piperazine.
| Compound Name | 1-[(1Z,3Z)-4-ethyl-1-fluorohexa-1,3,5-trienyl]piperazine |
|---|---|
| PubChem CID | 156792123 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-[(1Z,3Z)-4-ethyl-1-fluorohexa-1,3,5-trienyl]piperazine |
| SMILES | C=C/C(=C\C=C(/F)N1CCNCC1)CC |
| InChI | InChI=1S/C12H19FN2/c1-3-11(4-2)5-6-12(13)15-9-7-14-8-10-15/h3,5-6,14H,1,4,7-10H2,2H3/b11-5+,12-6+ |
| InChIKey | NCJGWXYVYBBLJR-YDWXAUTNSA-N |
| XLogP | 2.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|