C20H27BrN4OSi — CID 156792686
2-[[5-bromo-6-methyl-3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 156792686) has the molecular formula C20H27BrN4OSi and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-[[5-bromo-6-methyl-3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-6-methyl-3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 156792686 |
| Molecular Formula | C20H27BrN4OSi |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[[5-bromo-6-methyl-3-[(E)-2-(1-methylpyrazol-4-yl)ethenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc2c(cc1Br)c(/C=C/c1cnn(C)c1)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H27BrN4OSi/c1-15-10-20-17(11-18(15)21)19(7-6-16-12-22-24(2)13-16)23-25(20)14-26-8-9-27(3,4)5/h6-7,10-13H,8-9,14H2,1-5H3/b7-6+ |
| InChIKey | ZEVNISNSJAXRMJ-VOTSOKGWSA-N |
| XLogP | 5.32 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|