About 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole
4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole (PubChem CID 156792838) has the molecular formula C10H17BN2O2
and a molecular weight of 208.07 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole |
| PubChem CID | 156792838 |
| Molecular Formula | C10H17BN2O2 |
| Molecular Weight | 208.07 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole |
| SMILES | CC1OB(c2cnn(C(C)C)c2)OC1C |
| InChI | InChI=1S/C10H17BN2O2/c1-7(2)13-6-10(5-12-13)11-14-8(3)9(4)15-11/h5-9H,1-4H3 |
| InChIKey | RRWYQGPMIFKJLD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.07 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole?
The IUPAC name of 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole (CID 156792838) is 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole.
What is the SMILES notation for 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole?
The canonical SMILES for 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole is CC1OB(c2cnn(C(C)C)c2)OC1C.
What is the InChIKey of 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole?
The InChIKey is RRWYQGPMIFKJLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BN2O2/c1-7(2)13-6-10(5-12-13)11-14-8(3)9(4)15-11/h5-9H,1-4H3.
What are the key properties of 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole?
4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole has a molecular weight of 208.07 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethyl-1,3,2-dioxaborolan-2-yl)-1-propan-2-ylpyrazole is sourced from PubChem (CID 156792838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).