C14H13F3N2O3 — CID 156793781
3-[5-oxo-4-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-pyrrol-1-yl]piperidine-2,6-dione (PubChem CID 156793781) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 3-[5-oxo-4-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-pyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-oxo-4-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-pyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156793781 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-[5-oxo-4-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]-2H-pyrrol-1-yl]piperidine-2,6-dione |
| SMILES | C=C/C(=C\C1=CCN(C2CCC(=O)NC2=O)C1=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O3/c1-2-9(14(15,16)17)7-8-5-6-19(13(8)22)10-3-4-11(20)18-12(10)21/h2,5,7,10H,1,3-4,6H2,(H,18,20,21)/b9-7+ |
| InChIKey | PHJDCHIVZRQMOJ-VQHVLOKHSA-N |
| XLogP | 1.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|