About 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine
6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine (PubChem CID 156794082) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine.
Molecular Properties
| Compound Name | 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine |
| PubChem CID | 156794082 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine |
| SMILES | CC(C)C1(C)C=CC2=C(CCO2)N=C1 |
| InChI | InChI=1S/C12H17NO/c1-9(2)12(3)6-4-11-10(13-8-12)5-7-14-11/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | UULNNZUGEIGSEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine?
The IUPAC name of 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine (CID 156794082) is 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine.
What is the SMILES notation for 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine?
The canonical SMILES for 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine is CC(C)C1(C)C=CC2=C(CCO2)N=C1.
What is the InChIKey of 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine?
The InChIKey is UULNNZUGEIGSEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-9(2)12(3)6-4-11-10(13-8-12)5-7-14-11/h4,6,8-9H,5,7H2,1-3H3.
What are the key properties of 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine?
6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine has a molecular weight of 191.27 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6-propan-2-yl-2,3-dihydrofuro[3,2-b]azepine is sourced from PubChem (CID 156794082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).