About 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine
7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine (PubChem CID 156794167) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine.
Molecular Properties
| Compound Name | 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine |
| PubChem CID | 156794167 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine |
| SMILES | CC1(N)C=CC2=C(C=C1)OCCC2 |
| InChI | InChI=1S/C11H15NO/c1-11(12)6-4-9-3-2-8-13-10(9)5-7-11/h4-7H,2-3,8,12H2,1H3 |
| InChIKey | DMNMVMJQJDQBRE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine?
The IUPAC name of 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine (CID 156794167) is 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine.
What is the SMILES notation for 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine?
The canonical SMILES for 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine is CC1(N)C=CC2=C(C=C1)OCCC2.
What is the InChIKey of 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine?
The InChIKey is DMNMVMJQJDQBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-11(12)6-4-9-3-2-8-13-10(9)5-7-11/h4-7H,2-3,8,12H2,1H3.
What are the key properties of 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine?
7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine has a molecular weight of 177.25 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,4-dihydro-2H-cyclohepta[b]pyran-7-amine is sourced from PubChem (CID 156794167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).